C11H11FN2O2S — CID 79512370
3-amino-4-fluoro-N-(2-hydroxyethyl)-1-benzothiophene-2-carboxamide (PubChem CID 79512370) has the molecular formula C11H11FN2O2S and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-amino-4-fluoro-N-(2-hydroxyethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-4-fluoro-N-(2-hydroxyethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 79512370 |
| Molecular Formula | C11H11FN2O2S |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 3-amino-4-fluoro-N-(2-hydroxyethyl)-1-benzothiophene-2-carboxamide |
| SMILES | Nc1c(C(=O)NCCO)sc2cccc(F)c12 |
| InChI | InChI=1S/C11H11FN2O2S/c12-6-2-1-3-7-8(6)9(13)10(17-7)11(16)14-4-5-15/h1-3,15H,4-5,13H2,(H,14,16) |
| InChIKey | CWPVMZOWDBYPET-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |