C13H21N5OS2 — CID 106434169
4-amino-2-piperazin-1-yl-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-5-carboxamide (PubChem CID 106434169) has the molecular formula C13H21N5OS2 and a molecular weight of 327.48 g/mol. Its IUPAC name is 4-amino-2-piperazin-1-yl-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-piperazin-1-yl-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 106434169 |
| Molecular Formula | C13H21N5OS2 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 4-amino-2-piperazin-1-yl-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-5-carboxamide |
| SMILES | C=CCSCCNC(=O)c1sc(N2CCNCC2)nc1N |
| InChI | InChI=1S/C13H21N5OS2/c1-2-8-20-9-5-16-12(19)10-11(14)17-13(21-10)18-6-3-15-4-7-18/h2,15H,1,3-9,14H2,(H,16,19) |
| InChIKey | ARRPOIQEBPSIGS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|