C14H15N5OS3 — CID 177397980
[(E)-1-(4,5,12-trimethyl-2-oxo-6,10-dithia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-11-yl)ethylideneamino]thiourea (PubChem CID 177397980) has the molecular formula C14H15N5OS3 and a molecular weight of 365.51 g/mol. Its IUPAC name is [(E)-1-(4,5,12-trimethyl-2-oxo-6,10-dithia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-11-yl)ethylideneamino]thiourea.
| Compound Name | [(E)-1-(4,5,12-trimethyl-2-oxo-6,10-dithia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-11-yl)ethylideneamino]thiourea |
|---|---|
| PubChem CID | 177397980 |
| Molecular Formula | C14H15N5OS3 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | [(E)-1-(4,5,12-trimethyl-2-oxo-6,10-dithia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-11-yl)ethylideneamino]thiourea |
| SMILES | C/C(=N\NC(N)=S)c1sc2nc3sc(C)c(C)c3c(=O)n2c1C |
| InChI | InChI=1S/C14H15N5OS3/c1-5-8(4)22-11-9(5)12(20)19-7(3)10(23-14(19)16-11)6(2)17-18-13(15)21/h1-4H3,(H3,15,18,21)/b17-6+ |
| InChIKey | AVKYEBXLKWOFOF-UBKPWBPPSA-N |
| XLogP | 2.45 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|