C12H9BrClN3OS — CID 139235545
10-bromo-13-chloro-4,5,11-trimethyl-6-thia-1,8,12-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one (PubChem CID 139235545) has the molecular formula C12H9BrClN3OS and a molecular weight of 358.65 g/mol. Its IUPAC name is 10-bromo-13-chloro-4,5,11-trimethyl-6-thia-1,8,12-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one.
| Compound Name | 10-bromo-13-chloro-4,5,11-trimethyl-6-thia-1,8,12-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one |
|---|---|
| PubChem CID | 139235545 |
| Molecular Formula | C12H9BrClN3OS |
| Molecular Weight | 358.65 g/mol |
| Exact Mass | 356.93 |
| IUPAC Name | 10-bromo-13-chloro-4,5,11-trimethyl-6-thia-1,8,12-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one |
| SMILES | Cc1nc(Cl)n2c(=O)c3c(C)c(C)sc3nc2c1Br |
| InChI | InChI=1S/C12H9BrClN3OS/c1-4-6(3)19-10-7(4)11(18)17-9(16-10)8(13)5(2)15-12(17)14/h1-3H3 |
| InChIKey | XZRRCAVYARXHSD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.65 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |