C13H18N2OS — CID 23411257
3-butyl-2,5,6-trimethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 23411257) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 3-butyl-2,5,6-trimethylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-butyl-2,5,6-trimethylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 23411257 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-butyl-2,5,6-trimethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCCCn1c(C)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C13H18N2OS/c1-5-6-7-15-10(4)14-12-11(13(15)16)8(2)9(3)17-12/h5-7H2,1-4H3 |
| InChIKey | LSHFZMCQAFLASS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |