C16H25N3O3S3 — CID 56529051
3-(3-butyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-methylpropane-1-sulfonamide (PubChem CID 56529051) has the molecular formula C16H25N3O3S3 and a molecular weight of 403.60 g/mol. Its IUPAC name is 3-(3-butyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-methylpropane-1-sulfonamide.
| Compound Name | 3-(3-butyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 56529051 |
| Molecular Formula | C16H25N3O3S3 |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 3-(3-butyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-methylpropane-1-sulfonamide |
| SMILES | CCCCn1c(SCCCS(=O)(=O)NC)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C16H25N3O3S3/c1-5-6-8-19-15(20)13-11(2)12(3)24-14(13)18-16(19)23-9-7-10-25(21,22)17-4/h17H,5-10H2,1-4H3 |
| InChIKey | ZDZBSHOQZCAUEB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|