C18H15N3O3S — CID 155811621
(11Z)-11-[(4-methoxyphenyl)methylidene]-4,5-dimethyl-6-thia-1,8,10-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-2,12-dione (PubChem CID 155811621) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is (11Z)-11-[(4-methoxyphenyl)methylidene]-4,5-dimethyl-6-thia-1,8,10-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-2,12-dione.
| Compound Name | (11Z)-11-[(4-methoxyphenyl)methylidene]-4,5-dimethyl-6-thia-1,8,10-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-2,12-dione |
|---|---|
| PubChem CID | 155811621 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | (11Z)-11-[(4-methoxyphenyl)methylidene]-4,5-dimethyl-6-thia-1,8,10-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-2,12-dione |
| SMILES | COc1ccc(/C=c2\[nH]c3nc4sc(C)c(C)c4c(=O)n3c2=O)cc1 |
| InChI | InChI=1S/C18H15N3O3S/c1-9-10(2)25-15-14(9)17(23)21-16(22)13(19-18(21)20-15)8-11-4-6-12(24-3)7-5-11/h4-8H,1-3H3,(H,19,20)/b13-8- |
| InChIKey | YGXNELDQRFNVLT-JYRVWZFOSA-N |
| XLogP | 1.77 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |