C10H10N4OS — CID 101122728
4,5,12-trimethyl-6-thia-1,8,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one (PubChem CID 101122728) has the molecular formula C10H10N4OS and a molecular weight of 234.28 g/mol. Its IUPAC name is 4,5,12-trimethyl-6-thia-1,8,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one.
| Compound Name | 4,5,12-trimethyl-6-thia-1,8,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one |
|---|---|
| PubChem CID | 101122728 |
| Molecular Formula | C10H10N4OS |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 4,5,12-trimethyl-6-thia-1,8,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one |
| SMILES | Cc1sc2nc3[nH]nc(C)n3c(=O)c2c1C |
| InChI | InChI=1S/C10H10N4OS/c1-4-5(2)16-8-7(4)9(15)14-6(3)12-13-10(14)11-8/h1-3H3,(H,11,13) |
| InChIKey | RTCHMRLYCRMVHW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |