C12H11Cl2N3S — CID 86198516
3-(2,4-dichlorophenyl)-1,4-dimethylpyrazole-5-carbothioamide (PubChem CID 86198516) has the molecular formula C12H11Cl2N3S and a molecular weight of 300.21 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1,4-dimethylpyrazole-5-carbothioamide.
| Compound Name | 3-(2,4-dichlorophenyl)-1,4-dimethylpyrazole-5-carbothioamide |
|---|---|
| PubChem CID | 86198516 |
| Molecular Formula | C12H11Cl2N3S |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1,4-dimethylpyrazole-5-carbothioamide |
| SMILES | Cc1c(-c2ccc(Cl)cc2Cl)nn(C)c1C(N)=S |
| InChI | InChI=1S/C12H11Cl2N3S/c1-6-10(16-17(2)11(6)12(15)18)8-4-3-7(13)5-9(8)14/h3-5H,1-2H3,(H2,15,18) |
| InChIKey | LFKKWOGKVOVGFC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|