C15H10ClN3OS — CID 135439530
2-[5-[(E)-(2-chlorophenyl)methylideneamino]-1,3,4-thiadiazol-2-yl]phenol (PubChem CID 135439530) has the molecular formula C15H10ClN3OS and a molecular weight of 315.79 g/mol. Its IUPAC name is 2-[5-[(E)-(2-chlorophenyl)methylideneamino]-1,3,4-thiadiazol-2-yl]phenol.
| Compound Name | 2-[5-[(E)-(2-chlorophenyl)methylideneamino]-1,3,4-thiadiazol-2-yl]phenol |
|---|---|
| PubChem CID | 135439530 |
| Molecular Formula | C15H10ClN3OS |
| Molecular Weight | 315.79 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 2-[5-[(E)-(2-chlorophenyl)methylideneamino]-1,3,4-thiadiazol-2-yl]phenol |
| SMILES | Oc1ccccc1-c1nnc(/N=C/c2ccccc2Cl)s1 |
| InChI | InChI=1S/C15H10ClN3OS/c16-12-7-3-1-5-10(12)9-17-15-19-18-14(21-15)11-6-2-4-8-13(11)20/h1-9,20H/b17-9+ |
| InChIKey | OEZHAHQIZLRJFL-RQZCQDPDSA-N |
| XLogP | 4.31 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.79 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|