C13H10ClN5S — CID 10851997
(E)-1-(2-chlorophenyl)-N-[5-(pyrazol-1-ylmethyl)-1,3,4-thiadiazol-2-yl]methanimine (PubChem CID 10851997) has the molecular formula C13H10ClN5S and a molecular weight of 303.78 g/mol. Its IUPAC name is (E)-1-(2-chlorophenyl)-N-[5-(pyrazol-1-ylmethyl)-1,3,4-thiadiazol-2-yl]methanimine.
| Compound Name | (E)-1-(2-chlorophenyl)-N-[5-(pyrazol-1-ylmethyl)-1,3,4-thiadiazol-2-yl]methanimine |
|---|---|
| PubChem CID | 10851997 |
| Molecular Formula | C13H10ClN5S |
| Molecular Weight | 303.78 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | (E)-1-(2-chlorophenyl)-N-[5-(pyrazol-1-ylmethyl)-1,3,4-thiadiazol-2-yl]methanimine |
| SMILES | Clc1ccccc1/C=N/c1nnc(Cn2cccn2)s1 |
| InChI | InChI=1S/C13H10ClN5S/c14-11-5-2-1-4-10(11)8-15-13-18-17-12(20-13)9-19-7-3-6-16-19/h1-8H,9H2/b15-8+ |
| InChIKey | CUKHAYDSLNMUCI-OVCLIPMQSA-N |
| XLogP | 3.19 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.78 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|