C30H30N12 — CID 15190545
1-[[2,3,4,5,6-pentakis(pyrazol-1-ylmethyl)phenyl]methyl]pyrazole (PubChem CID 15190545) has the molecular formula C30H30N12 and a molecular weight of 558.65 g/mol. Its IUPAC name is 1-[[2,3,4,5,6-pentakis(pyrazol-1-ylmethyl)phenyl]methyl]pyrazole.
| Compound Name | 1-[[2,3,4,5,6-pentakis(pyrazol-1-ylmethyl)phenyl]methyl]pyrazole |
|---|---|
| PubChem CID | 15190545 |
| Molecular Formula | C30H30N12 |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | 1-[[2,3,4,5,6-pentakis(pyrazol-1-ylmethyl)phenyl]methyl]pyrazole |
| SMILES | c1cnn(Cc2c(Cn3cccn3)c(Cn3cccn3)c(Cn3cccn3)c(Cn3cccn3)c2Cn2cccn2)c1 |
| InChI | InChI=1S/C30H30N12/c1-7-31-37(13-1)19-25-26(20-38-14-2-8-32-38)28(22-40-16-4-10-34-40)30(24-42-18-6-12-36-42)29(23-41-17-5-11-35-41)27(25)21-39-15-3-9-33-39/h1-18H,19-24H2 |
| InChIKey | JKWQWVDZSGMCFM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 106.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |