C12H14N2 — CID 79032553
1-[(2,6-dimethylphenyl)methyl]pyrazole (PubChem CID 79032553) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 1-[(2,6-dimethylphenyl)methyl]pyrazole.
| Compound Name | 1-[(2,6-dimethylphenyl)methyl]pyrazole |
|---|---|
| PubChem CID | 79032553 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1-[(2,6-dimethylphenyl)methyl]pyrazole |
| SMILES | Cc1cccc(C)c1Cn1cccn1 |
| InChI | InChI=1S/C12H14N2/c1-10-5-3-6-11(2)12(10)9-14-8-4-7-13-14/h3-8H,9H2,1-2H3 |
| InChIKey | PEGWMPGOWBCQTG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |