C44H40N16 — CID 139060151
1-[[1,3,4,5,6,7,8-heptakis(pyrazol-1-ylmethyl)biphenylen-2-yl]methyl]pyrazole (PubChem CID 139060151) has the molecular formula C44H40N16 and a molecular weight of 792.92 g/mol. Its IUPAC name is 1-[[1,3,4,5,6,7,8-heptakis(pyrazol-1-ylmethyl)biphenylen-2-yl]methyl]pyrazole.
| Compound Name | 1-[[1,3,4,5,6,7,8-heptakis(pyrazol-1-ylmethyl)biphenylen-2-yl]methyl]pyrazole |
|---|---|
| PubChem CID | 139060151 |
| Molecular Formula | C44H40N16 |
| Molecular Weight | 792.92 g/mol |
| Exact Mass | 792.36 |
| IUPAC Name | 1-[[1,3,4,5,6,7,8-heptakis(pyrazol-1-ylmethyl)biphenylen-2-yl]methyl]pyrazole |
| SMILES | c1cnn(Cc2c(Cn3cccn3)c(Cn3cccn3)c3c(c2Cn2cccn2)-c2c(Cn4cccn4)c(Cn4cccn4)c(Cn4cccn4)c(Cn4cccn4)c2-3)c1 |
| InChI | InChI=1S/C44H40N16/c1-9-45-53(17-1)25-33-34(26-54-18-2-10-46-54)38(30-58-22-6-14-50-58)42-41(37(33)29-57-21-5-13-49-57)43-39(31-59-23-7-15-51-59)35(27-55-19-3-11-47-55)36(28-56-20-4-12-48-56)40(44(42)43)32-60-24-8-16-52-60/h1-24H,25-32H2 |
| InChIKey | BWLLJGOJMWNZBT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 142.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.92 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |