C24H30N6 — CID 91461332
1-[[2,4,6-triethyl-3,5-bis(pyrazol-1-ylmethyl)phenyl]methyl]pyrazole (PubChem CID 91461332) has the molecular formula C24H30N6 and a molecular weight of 402.55 g/mol. Its IUPAC name is 1-[[2,4,6-triethyl-3,5-bis(pyrazol-1-ylmethyl)phenyl]methyl]pyrazole.
| Compound Name | 1-[[2,4,6-triethyl-3,5-bis(pyrazol-1-ylmethyl)phenyl]methyl]pyrazole |
|---|---|
| PubChem CID | 91461332 |
| Molecular Formula | C24H30N6 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 1-[[2,4,6-triethyl-3,5-bis(pyrazol-1-ylmethyl)phenyl]methyl]pyrazole |
| SMILES | CCc1c(Cn2cccn2)c(CC)c(Cn2cccn2)c(CC)c1Cn1cccn1 |
| InChI | InChI=1S/C24H30N6/c1-4-19-22(16-28-13-7-10-25-28)20(5-2)24(18-30-15-9-12-27-30)21(6-3)23(19)17-29-14-8-11-26-29/h7-15H,4-6,16-18H2,1-3H3 |
| InChIKey | UYNPEZYHWRLADB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |