About ethane;(4-ethylphenyl)methanamine;1-[(4-methylphenyl)methyl]pyrazole
ethane;(4-ethylphenyl)methanamine;1-[(4-methylphenyl)methyl]pyrazole (PubChem CID 176952887) has the molecular formula C24H37N3
and a molecular weight of 367.58 g/mol. Its IUPAC name is ethane;(4-ethylphenyl)methanamine;1-[(4-methylphenyl)methyl]pyrazole.
Molecular Properties
| Compound Name | ethane;(4-ethylphenyl)methanamine;1-[(4-methylphenyl)methyl]pyrazole |
| PubChem CID | 176952887 |
| Molecular Formula | C24H37N3 |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.30 |
| IUPAC Name | ethane;(4-ethylphenyl)methanamine;1-[(4-methylphenyl)methyl]pyrazole |
| SMILES | CC.CC.CCc1ccc(CN)cc1.Cc1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C11H12N2.C9H13N.2C2H6/c1-10-3-5-11(6-4-10)9-13-8-2-7-12-13;1-2-8-3-5-9(7-10)6-4-8;2*1-2/h2-8H,9H2,1H3;3-6H,2,7,10H2,1H3;2*1-2H3 |
| InChIKey | CDFXBEOUCQRJKT-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;(4-ethylphenyl)methanamine;1-[(4-methylphenyl)methyl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4-ethylphenyl)methanamine;1-[(4-methylphenyl)methyl]pyrazole?
The IUPAC name of ethane;(4-ethylphenyl)methanamine;1-[(4-methylphenyl)methyl]pyrazole (CID 176952887) is ethane;(4-ethylphenyl)methanamine;1-[(4-methylphenyl)methyl]pyrazole.
What is the SMILES notation for ethane;(4-ethylphenyl)methanamine;1-[(4-methylphenyl)methyl]pyrazole?
The canonical SMILES for ethane;(4-ethylphenyl)methanamine;1-[(4-methylphenyl)methyl]pyrazole is CC.CC.CCc1ccc(CN)cc1.Cc1ccc(Cn2cccn2)cc1.
What is the InChIKey of ethane;(4-ethylphenyl)methanamine;1-[(4-methylphenyl)methyl]pyrazole?
The InChIKey is CDFXBEOUCQRJKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2.C9H13N.2C2H6/c1-10-3-5-11(6-4-10)9-13-8-2-7-12-13;1-2-8-3-5-9(7-10)6-4-8;2*1-2/h2-8H,9H2,1H3;3-6H,2,7,10H2,1H3;2*1-2H3.
What are the key properties of ethane;(4-ethylphenyl)methanamine;1-[(4-methylphenyl)methyl]pyrazole?
ethane;(4-ethylphenyl)methanamine;1-[(4-methylphenyl)methyl]pyrazole has a molecular weight of 367.58 g/mol, XLogP of 6.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4-ethylphenyl)methanamine;1-[(4-methylphenyl)methyl]pyrazole is sourced from PubChem (CID 176952887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).