C19H18N2O2 — CID 30002423
(2,4-dimethylphenyl) 4-(pyrazol-1-ylmethyl)benzoate (PubChem CID 30002423) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is (2,4-dimethylphenyl) 4-(pyrazol-1-ylmethyl)benzoate.
| Compound Name | (2,4-dimethylphenyl) 4-(pyrazol-1-ylmethyl)benzoate |
|---|---|
| PubChem CID | 30002423 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (2,4-dimethylphenyl) 4-(pyrazol-1-ylmethyl)benzoate |
| SMILES | Cc1ccc(OC(=O)c2ccc(Cn3cccn3)cc2)c(C)c1 |
| InChI | InChI=1S/C19H18N2O2/c1-14-4-9-18(15(2)12-14)23-19(22)17-7-5-16(6-8-17)13-21-11-3-10-20-21/h3-12H,13H2,1-2H3 |
| InChIKey | PQOPOOCOYCXTPD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|