C17H18O3 — CID 55383167
(2,4-dimethylphenyl) 3-(methoxymethyl)benzoate (PubChem CID 55383167) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is (2,4-dimethylphenyl) 3-(methoxymethyl)benzoate.
| Compound Name | (2,4-dimethylphenyl) 3-(methoxymethyl)benzoate |
|---|---|
| PubChem CID | 55383167 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (2,4-dimethylphenyl) 3-(methoxymethyl)benzoate |
| SMILES | COCc1cccc(C(=O)Oc2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C17H18O3/c1-12-7-8-16(13(2)9-12)20-17(18)15-6-4-5-14(10-15)11-19-3/h4-10H,11H2,1-3H3 |
| InChIKey | YPRYBTDTBPPTMA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|