C13H9N3S2 — CID 139076781
(E)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-1-thiophen-2-ylmethanimine (PubChem CID 139076781) has the molecular formula C13H9N3S2 and a molecular weight of 271.37 g/mol. Its IUPAC name is (E)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-1-thiophen-2-ylmethanimine.
| Compound Name | (E)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-1-thiophen-2-ylmethanimine |
|---|---|
| PubChem CID | 139076781 |
| Molecular Formula | C13H9N3S2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | (E)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-1-thiophen-2-ylmethanimine |
| SMILES | C(=N/c1nnc(-c2ccccc2)s1)\c1cccs1 |
| InChI | InChI=1S/C13H9N3S2/c1-2-5-10(6-3-1)12-15-16-13(18-12)14-9-11-7-4-8-17-11/h1-9H/b14-9+ |
| InChIKey | YOLSMNNCOSNMCM-NTEUORMPSA-N |
| XLogP | 4.02 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|