C11H4F5NS — CID 2351568
N-(2,3,4,5,6-pentafluorophenyl)-1-thiophen-2-ylmethanimine (PubChem CID 2351568) has the molecular formula C11H4F5NS and a molecular weight of 277.22 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentafluorophenyl)-1-thiophen-2-ylmethanimine.
| Compound Name | N-(2,3,4,5,6-pentafluorophenyl)-1-thiophen-2-ylmethanimine |
|---|---|
| PubChem CID | 2351568 |
| Molecular Formula | C11H4F5NS |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | N-(2,3,4,5,6-pentafluorophenyl)-1-thiophen-2-ylmethanimine |
| SMILES | Fc1c(F)c(F)c(/N=C/c2cccs2)c(F)c1F |
| InChI | InChI=1S/C11H4F5NS/c12-6-7(13)9(15)11(10(16)8(6)14)17-4-5-2-1-3-18-5/h1-4H/b17-4+ |
| InChIKey | LFRCGZOZYOMXIT-HAVNEIBRSA-N |
| XLogP | 4.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|