C16H10BrN3O2S — CID 171980448
(E)-1-(7-bromo-1,3-benzodioxol-5-yl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)methanimine (PubChem CID 171980448) has the molecular formula C16H10BrN3O2S and a molecular weight of 388.25 g/mol. Its IUPAC name is (E)-1-(7-bromo-1,3-benzodioxol-5-yl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)methanimine.
| Compound Name | (E)-1-(7-bromo-1,3-benzodioxol-5-yl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)methanimine |
|---|---|
| PubChem CID | 171980448 |
| Molecular Formula | C16H10BrN3O2S |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | (E)-1-(7-bromo-1,3-benzodioxol-5-yl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)methanimine |
| SMILES | Brc1cc(/C=N/c2nnc(-c3ccccc3)s2)cc2c1OCO2 |
| InChI | InChI=1S/C16H10BrN3O2S/c17-12-6-10(7-13-14(12)22-9-21-13)8-18-16-20-19-15(23-16)11-4-2-1-3-5-11/h1-8H,9H2/b18-8+ |
| InChIKey | VCCYPTKPGHIYRD-QGMBQPNBSA-N |
| XLogP | 4.45 |
| TPSA | 56.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|