C14H9BrO4S — CID 43343973
(E)-3-(7-bromo-1,3-benzodioxol-5-yl)-2-thiophen-2-ylprop-2-enoic acid (PubChem CID 43343973) has the molecular formula C14H9BrO4S and a molecular weight of 353.19 g/mol. Its IUPAC name is (E)-3-(7-bromo-1,3-benzodioxol-5-yl)-2-thiophen-2-ylprop-2-enoic acid.
| Compound Name | (E)-3-(7-bromo-1,3-benzodioxol-5-yl)-2-thiophen-2-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 43343973 |
| Molecular Formula | C14H9BrO4S |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 351.94 |
| IUPAC Name | (E)-3-(7-bromo-1,3-benzodioxol-5-yl)-2-thiophen-2-ylprop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1cc(Br)c2c(c1)OCO2)c1cccs1 |
| InChI | InChI=1S/C14H9BrO4S/c15-10-5-8(6-11-13(10)19-7-18-11)4-9(14(16)17)12-2-1-3-20-12/h1-6H,7H2,(H,16,17)/b9-4- |
| InChIKey | TVUAWUPCKYVTSN-WTKPLQERSA-N |
| XLogP | 3.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|