C11H8BrFO4 — CID 79727148
3-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-fluoroprop-2-enoic acid (PubChem CID 79727148) has the molecular formula C11H8BrFO4 and a molecular weight of 303.08 g/mol. Its IUPAC name is 3-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-fluoroprop-2-enoic acid.
| Compound Name | 3-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 79727148 |
| Molecular Formula | C11H8BrFO4 |
| Molecular Weight | 303.08 g/mol |
| Exact Mass | 301.96 |
| IUPAC Name | 3-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-fluoroprop-2-enoic acid |
| SMILES | O=C(O)C(F)=Cc1cc(Br)c2c(c1)OCCO2 |
| InChI | InChI=1S/C11H8BrFO4/c12-7-3-6(4-8(13)11(14)15)5-9-10(7)17-2-1-16-9/h3-5H,1-2H2,(H,14,15) |
| InChIKey | KDHVAELFHVWRDZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.08 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|