C12H11BrO3 — CID 79331610
3-(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enal (PubChem CID 79331610) has the molecular formula C12H11BrO3 and a molecular weight of 283.12 g/mol. Its IUPAC name is 3-(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enal.
| Compound Name | 3-(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enal |
|---|---|
| PubChem CID | 79331610 |
| Molecular Formula | C12H11BrO3 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 3-(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enal |
| SMILES | O=CC=Cc1cc(Br)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C12H11BrO3/c13-10-7-9(3-1-4-14)8-11-12(10)16-6-2-5-15-11/h1,3-4,7-8H,2,5-6H2 |
| InChIKey | LXHRVQMUEFYQMA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|