C11H11BrO3 — CID 62772737
6-bromo-8-(oxiran-2-yl)-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 62772737) has the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. Its IUPAC name is 6-bromo-8-(oxiran-2-yl)-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 6-bromo-8-(oxiran-2-yl)-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 62772737 |
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 6-bromo-8-(oxiran-2-yl)-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | Brc1cc(C2CO2)cc2c1OCCCO2 |
| InChI | InChI=1S/C11H11BrO3/c12-8-4-7(10-6-15-10)5-9-11(8)14-3-1-2-13-9/h4-5,10H,1-3,6H2 |
| InChIKey | WJOFWCGTBQONLA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|