C11H13BrO5S — CID 102620940
(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl methanesulfonate (PubChem CID 102620940) has the molecular formula C11H13BrO5S and a molecular weight of 337.19 g/mol. Its IUPAC name is (6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl methanesulfonate.
| Compound Name | (6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl methanesulfonate |
|---|---|
| PubChem CID | 102620940 |
| Molecular Formula | C11H13BrO5S |
| Molecular Weight | 337.19 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | (6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1cc(Br)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C11H13BrO5S/c1-18(13,14)17-7-8-5-9(12)11-10(6-8)15-3-2-4-16-11/h5-6H,2-4,7H2,1H3 |
| InChIKey | CICMDMVTSVODBS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|