About 2-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxy]acetic acid
2-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxy]acetic acid (PubChem CID 121210349) has the molecular formula C10H9BrO5
and a molecular weight of 289.08 g/mol. Its IUPAC name is 2-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxy]acetic acid.
Analyze 2-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxy]acetic acid?
The IUPAC name of 2-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxy]acetic acid (CID 121210349) is 2-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxy]acetic acid.
What is the SMILES notation for 2-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxy]acetic acid?
The canonical SMILES for 2-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxy]acetic acid is O=C(O)COc1cc(Br)c2c(c1)OCCO2.
What is the InChIKey of 2-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxy]acetic acid?
The InChIKey is GWEAOBDQFAYFLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrO5/c11-7-3-6(16-5-9(12)13)4-8-10(7)15-2-1-14-8/h3-4H,1-2,5H2,(H,12,13).
What are the key properties of 2-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxy]acetic acid?
2-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxy]acetic acid has a molecular weight of 289.08 g/mol, XLogP of 1.68, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxy]acetic acid is sourced from PubChem (CID 121210349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).