7-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid

C10H9BrO5 — CID 117466605

IUPAC7-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid
SMILESCOc1c(Br)cc2c(c1C(=O)O)OCCO2
InChIInChI=1S/C10H9BrO5/c1-14-8-5(11)4-6-9(7(8)10(12)13)16-3-2-15-6/h4H,2-3H2,1H3,(H,12,13)
InChIKeyICAWVCRATITRDN-UHFFFAOYSA-N
MW289.08 g/mol
LogP1.93
Rot. Bonds2

About 7-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid

7-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid (PubChem CID 117466605) has the molecular formula C10H9BrO5 and a molecular weight of 289.08 g/mol. Its IUPAC name is 7-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid.

Molecular Properties

Compound Name7-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid
PubChem CID117466605
Molecular FormulaC10H9BrO5
Molecular Weight289.08 g/mol
Exact Mass287.96
IUPAC Name7-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid
SMILESCOc1c(Br)cc2c(c1C(=O)O)OCCO2
InChIInChI=1S/C10H9BrO5/c1-14-8-5(11)4-6-9(7(8)10(12)13)16-3-2-15-6/h4H,2-3H2,1H3,(H,12,13)
InChIKeyICAWVCRATITRDN-UHFFFAOYSA-N
XLogP1.93
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.08
LogP ≤ 51.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 7-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid?
The IUPAC name of 7-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid (CID 117466605) is 7-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid.
What is the SMILES notation for 7-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid?
The canonical SMILES for 7-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid is COc1c(Br)cc2c(c1C(=O)O)OCCO2.
What is the InChIKey of 7-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid?
The InChIKey is ICAWVCRATITRDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrO5/c1-14-8-5(11)4-6-9(7(8)10(12)13)16-3-2-15-6/h4H,2-3H2,1H3,(H,12,13).
What are the key properties of 7-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid?
7-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid has a molecular weight of 289.08 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid is sourced from PubChem (CID 117466605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).