C12H13BrO3 — CID 103091014
(E)-4-(7-bromo-1,3-benzodioxol-5-yl)-3-methylbut-3-en-2-ol (PubChem CID 103091014) has the molecular formula C12H13BrO3 and a molecular weight of 285.14 g/mol. Its IUPAC name is (E)-4-(7-bromo-1,3-benzodioxol-5-yl)-3-methylbut-3-en-2-ol.
| Compound Name | (E)-4-(7-bromo-1,3-benzodioxol-5-yl)-3-methylbut-3-en-2-ol |
|---|---|
| PubChem CID | 103091014 |
| Molecular Formula | C12H13BrO3 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | (E)-4-(7-bromo-1,3-benzodioxol-5-yl)-3-methylbut-3-en-2-ol |
| SMILES | C/C(=C\c1cc(Br)c2c(c1)OCO2)C(C)O |
| InChI | InChI=1S/C12H13BrO3/c1-7(8(2)14)3-9-4-10(13)12-11(5-9)15-6-16-12/h3-5,8,14H,6H2,1-2H3/b7-3+ |
| InChIKey | RPRJZRAHXFIUGP-XVNBXDOJSA-N |
| XLogP | 2.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |