C15H15BrIN3O2 — CID 110926869
2-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-1-phenylguanidine;hydroiodide (PubChem CID 110926869) has the molecular formula C15H15BrIN3O2 and a molecular weight of 476.11 g/mol. Its IUPAC name is 2-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-1-phenylguanidine;hydroiodide.
| Compound Name | 2-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110926869 |
| Molecular Formula | C15H15BrIN3O2 |
| Molecular Weight | 476.11 g/mol |
| Exact Mass | 474.94 |
| IUPAC Name | 2-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-1-phenylguanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1cc(Br)c2c(c1)OCO2)Nc1ccccc1 |
| InChI | InChI=1S/C15H14BrN3O2.HI/c16-12-6-10(7-13-14(12)21-9-20-13)8-18-15(17)19-11-4-2-1-3-5-11;/h1-7H,8-9H2,(H3,17,18,19);1H |
| InChIKey | QPCWCZZJAHIBOH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.11 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|