C19H12BrN3OS — CID 171980446
(E)-1-[5-(4-bromophenyl)furan-2-yl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)methanimine (PubChem CID 171980446) has the molecular formula C19H12BrN3OS and a molecular weight of 410.30 g/mol. Its IUPAC name is (E)-1-[5-(4-bromophenyl)furan-2-yl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)methanimine.
| Compound Name | (E)-1-[5-(4-bromophenyl)furan-2-yl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)methanimine |
|---|---|
| PubChem CID | 171980446 |
| Molecular Formula | C19H12BrN3OS |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | (E)-1-[5-(4-bromophenyl)furan-2-yl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)methanimine |
| SMILES | Brc1ccc(-c2ccc(/C=N/c3nnc(-c4ccccc4)s3)o2)cc1 |
| InChI | InChI=1S/C19H12BrN3OS/c20-15-8-6-13(7-9-15)17-11-10-16(24-17)12-21-19-23-22-18(25-19)14-4-2-1-3-5-14/h1-12H/b21-12+ |
| InChIKey | LHHKBMLCNOLMSY-CIAFOILYSA-N |
| XLogP | 5.98 |
| TPSA | 51.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|