C18H12BrN3O — CID 23908299
N-(1H-benzimidazol-2-yl)-1-[5-(4-bromophenyl)furan-2-yl]methanimine (PubChem CID 23908299) has the molecular formula C18H12BrN3O and a molecular weight of 366.22 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-yl)-1-[5-(4-bromophenyl)furan-2-yl]methanimine.
| Compound Name | N-(1H-benzimidazol-2-yl)-1-[5-(4-bromophenyl)furan-2-yl]methanimine |
|---|---|
| PubChem CID | 23908299 |
| Molecular Formula | C18H12BrN3O |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | N-(1H-benzimidazol-2-yl)-1-[5-(4-bromophenyl)furan-2-yl]methanimine |
| SMILES | Brc1ccc(-c2ccc(C=Nc3nc4ccccc4[nH]3)o2)cc1 |
| InChI | InChI=1S/C18H12BrN3O/c19-13-7-5-12(6-8-13)17-10-9-14(23-17)11-20-18-21-15-3-1-2-4-16(15)22-18/h1-11H,(H,21,22) |
| InChIKey | QSFPOZPZBYBFSL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|