C20H16N4O3 — CID 40533746
methyl 4-[5-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]furan-2-yl]benzoate (PubChem CID 40533746) has the molecular formula C20H16N4O3 and a molecular weight of 360.37 g/mol. Its IUPAC name is methyl 4-[5-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 40533746 |
| Molecular Formula | C20H16N4O3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | methyl 4-[5-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(/C=N\Nc3nc4ccccc4[nH]3)o2)cc1 |
| InChI | InChI=1S/C20H16N4O3/c1-26-19(25)14-8-6-13(7-9-14)18-11-10-15(27-18)12-21-24-20-22-16-4-2-3-5-17(16)23-20/h2-12H,1H3,(H2,22,23,24)/b21-12- |
| InChIKey | GDWFKARUYAZNQV-MTJSOVHGSA-N |
| XLogP | 4.06 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|