C14H12Cl2N2OS — CID 135799813
2,4-dichloro-6-[(E)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yliminomethyl]phenol (PubChem CID 135799813) has the molecular formula C14H12Cl2N2OS and a molecular weight of 327.24 g/mol. Its IUPAC name is 2,4-dichloro-6-[(E)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yliminomethyl]phenol.
| Compound Name | 2,4-dichloro-6-[(E)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yliminomethyl]phenol |
|---|---|
| PubChem CID | 135799813 |
| Molecular Formula | C14H12Cl2N2OS |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 2,4-dichloro-6-[(E)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yliminomethyl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1/C=N/c1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C14H12Cl2N2OS/c15-9-5-8(13(19)10(16)6-9)7-17-14-18-11-3-1-2-4-12(11)20-14/h5-7,19H,1-4H2/b17-7+ |
| InChIKey | JMJQKTMGJVWIEV-REZTVBANSA-N |
| XLogP | 4.78 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|