C18H17N3OS — CID 54590014
(E)-N-[5-(3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]-1-(4-methoxyphenyl)methanimine (PubChem CID 54590014) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is (E)-N-[5-(3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]-1-(4-methoxyphenyl)methanimine.
| Compound Name | (E)-N-[5-(3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]-1-(4-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 54590014 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (E)-N-[5-(3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]-1-(4-methoxyphenyl)methanimine |
| SMILES | COc1ccc(/C=N/c2nnc(-c3cc(C)cc(C)c3)s2)cc1 |
| InChI | InChI=1S/C18H17N3OS/c1-12-8-13(2)10-15(9-12)17-20-21-18(23-17)19-11-14-4-6-16(22-3)7-5-14/h4-11H,1-3H3/b19-11+ |
| InChIKey | LMZNFDUYKZJXHB-YBFXNURJSA-N |
| XLogP | 4.58 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|