C18H14N4O2S — CID 45258110
(E)-1-(4-methoxyphenyl)-N-(8-methoxy-[1,3,4]thiadiazino[6,5-b]indol-3-yl)methanimine (PubChem CID 45258110) has the molecular formula C18H14N4O2S and a molecular weight of 350.40 g/mol. Its IUPAC name is (E)-1-(4-methoxyphenyl)-N-(8-methoxy-[1,3,4]thiadiazino[6,5-b]indol-3-yl)methanimine.
| Compound Name | (E)-1-(4-methoxyphenyl)-N-(8-methoxy-[1,3,4]thiadiazino[6,5-b]indol-3-yl)methanimine |
|---|---|
| PubChem CID | 45258110 |
| Molecular Formula | C18H14N4O2S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (E)-1-(4-methoxyphenyl)-N-(8-methoxy-[1,3,4]thiadiazino[6,5-b]indol-3-yl)methanimine |
| SMILES | COc1ccc(/C=N/c2nnc3c4cc(OC)ccc4nc-3s2)cc1 |
| InChI | InChI=1S/C18H14N4O2S/c1-23-12-5-3-11(4-6-12)10-19-18-22-21-16-14-9-13(24-2)7-8-15(14)20-17(16)25-18/h3-10H,1-2H3/b19-10+ |
| InChIKey | OJVVKYDCKLKAIL-VXLYETTFSA-N |
| XLogP | 3.96 |
| TPSA | 69.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|