C26H30ClN7S — CID 4158039
N-[[2-(4-chlorophenyl)sulfanylphenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 4158039) has the molecular formula C26H30ClN7S and a molecular weight of 508.10 g/mol. Its IUPAC name is N-[[2-(4-chlorophenyl)sulfanylphenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-[[2-(4-chlorophenyl)sulfanylphenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 4158039 |
| Molecular Formula | C26H30ClN7S |
| Molecular Weight | 508.10 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | N-[[2-(4-chlorophenyl)sulfanylphenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | Clc1ccc(Sc2ccccc2C=NNc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C26H30ClN7S/c27-21-11-13-22(14-12-21)35-23-10-4-3-9-20(23)19-28-32-24-29-25(33-15-5-1-6-16-33)31-26(30-24)34-17-7-2-8-18-34/h3-4,9-14,19H,1-2,5-8,15-18H2,(H,29,30,31,32) |
| InChIKey | HYEMNJKTTFCIMC-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.10 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|