C22H28ClN7 — CID 2844286
N-[3-(2-chlorophenyl)prop-2-enylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 2844286) has the molecular formula C22H28ClN7 and a molecular weight of 425.97 g/mol. Its IUPAC name is N-[3-(2-chlorophenyl)prop-2-enylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-[3-(2-chlorophenyl)prop-2-enylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 2844286 |
| Molecular Formula | C22H28ClN7 |
| Molecular Weight | 425.97 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[3-(2-chlorophenyl)prop-2-enylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | Clc1ccccc1C=CC=NNc1nc(N2CCCCC2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C22H28ClN7/c23-19-12-4-3-10-18(19)11-9-13-24-28-20-25-21(29-14-5-1-6-15-29)27-22(26-20)30-16-7-2-8-17-30/h3-4,9-13H,1-2,5-8,14-17H2,(H,25,26,27,28) |
| InChIKey | WHBPKKYZXJNKAR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.97 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|