C24H34N8 — CID 3888608
N-[3-[4-(dimethylamino)phenyl]prop-2-enylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 3888608) has the molecular formula C24H34N8 and a molecular weight of 434.59 g/mol. Its IUPAC name is N-[3-[4-(dimethylamino)phenyl]prop-2-enylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-[3-[4-(dimethylamino)phenyl]prop-2-enylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 3888608 |
| Molecular Formula | C24H34N8 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | N-[3-[4-(dimethylamino)phenyl]prop-2-enylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CN(C)c1ccc(C=CC=NNc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C24H34N8/c1-30(2)21-13-11-20(12-14-21)10-9-15-25-29-22-26-23(31-16-5-3-6-17-31)28-24(27-22)32-18-7-4-8-19-32/h9-15H,3-8,16-19H2,1-2H3,(H,26,27,28,29) |
| InChIKey | UKQOKNKGPFYGJU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|