C29H24FN7O5S — CID 136612146
N-[7-fluoro-6-(4-methylpiperazin-1-yl)-2-[2-(5-nitrofuran-2-yl)ethenyl]quinazolin-4-yl]-2-(2-hydroxyphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 136612146) has the molecular formula C29H24FN7O5S and a molecular weight of 601.62 g/mol. Its IUPAC name is N-[7-fluoro-6-(4-methylpiperazin-1-yl)-2-[2-(5-nitrofuran-2-yl)ethenyl]quinazolin-4-yl]-2-(2-hydroxyphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[7-fluoro-6-(4-methylpiperazin-1-yl)-2-[2-(5-nitrofuran-2-yl)ethenyl]quinazolin-4-yl]-2-(2-hydroxyphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 136612146 |
| Molecular Formula | C29H24FN7O5S |
| Molecular Weight | 601.62 g/mol |
| Exact Mass | 601.15 |
| IUPAC Name | N-[7-fluoro-6-(4-methylpiperazin-1-yl)-2-[2-(5-nitrofuran-2-yl)ethenyl]quinazolin-4-yl]-2-(2-hydroxyphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | CN1CCN(c2cc3c(NC(=O)c4csc(-c5ccccc5O)n4)nc(C=Cc4ccc([N+](=O)[O-])o4)nc3cc2F)CC1 |
| InChI | InChI=1S/C29H24FN7O5S/c1-35-10-12-36(13-11-35)23-14-19-21(15-20(23)30)31-25(8-6-17-7-9-26(42-17)37(40)41)33-27(19)34-28(39)22-16-43-29(32-22)18-4-2-3-5-24(18)38/h2-9,14-16,38H,10-13H2,1H3,(H,31,33,34,39) |
| InChIKey | ICTZWJUTXFLIPL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 150.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|