C21H20ClFN4O4 — CID 59743277
4-[3-[4-chloro-6-fluoro-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]quinazolin-7-yl]propyl]morpholine (PubChem CID 59743277) has the molecular formula C21H20ClFN4O4 and a molecular weight of 446.87 g/mol. Its IUPAC name is 4-[3-[4-chloro-6-fluoro-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]quinazolin-7-yl]propyl]morpholine.
| Compound Name | 4-[3-[4-chloro-6-fluoro-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]quinazolin-7-yl]propyl]morpholine |
|---|---|
| PubChem CID | 59743277 |
| Molecular Formula | C21H20ClFN4O4 |
| Molecular Weight | 446.87 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 4-[3-[4-chloro-6-fluoro-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]quinazolin-7-yl]propyl]morpholine |
| SMILES | O=[N+]([O-])c1ccc(/C=C/c2nc(Cl)c3cc(F)c(CCCN4CCOCC4)cc3n2)o1 |
| InChI | InChI=1S/C21H20ClFN4O4/c22-21-16-13-17(23)14(2-1-7-26-8-10-30-11-9-26)12-18(16)24-19(25-21)5-3-15-4-6-20(31-15)27(28)29/h3-6,12-13H,1-2,7-11H2/b5-3+ |
| InChIKey | XVVISUYXFDFLSV-HWKANZROSA-N |
| XLogP | 4.36 |
| TPSA | 94.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.87 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|