C20H12F2N4O4 — CID 140510614
4-[[6,7-difluoro-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]quinazolin-4-yl]amino]phenol (PubChem CID 140510614) has the molecular formula C20H12F2N4O4 and a molecular weight of 410.34 g/mol. Its IUPAC name is 4-[[6,7-difluoro-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]quinazolin-4-yl]amino]phenol.
| Compound Name | 4-[[6,7-difluoro-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]quinazolin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 140510614 |
| Molecular Formula | C20H12F2N4O4 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 4-[[6,7-difluoro-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]quinazolin-4-yl]amino]phenol |
| SMILES | O=[N+]([O-])c1ccc(/C=C/c2nc(Nc3ccc(O)cc3)c3cc(F)c(F)cc3n2)o1 |
| InChI | InChI=1S/C20H12F2N4O4/c21-15-9-14-17(10-16(15)22)24-18(7-5-13-6-8-19(30-13)26(28)29)25-20(14)23-11-1-3-12(27)4-2-11/h1-10,27H,(H,23,24,25)/b7-5+ |
| InChIKey | XSSHJZPIOLSYHU-FNORWQNLSA-N |
| XLogP | 5.03 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|