C19H19N7O3 — CID 11646853
4-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-6-(4-phenylpiperazin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 11646853) has the molecular formula C19H19N7O3 and a molecular weight of 393.41 g/mol. Its IUPAC name is 4-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-6-(4-phenylpiperazin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-6-(4-phenylpiperazin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 11646853 |
| Molecular Formula | C19H19N7O3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 4-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-6-(4-phenylpiperazin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(/C=C/c2ccc([N+](=O)[O-])o2)nc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C19H19N7O3/c20-18-21-16(8-6-15-7-9-17(29-15)26(27)28)22-19(23-18)25-12-10-24(11-13-25)14-4-2-1-3-5-14/h1-9H,10-13H2,(H2,20,21,22,23)/b8-6+ |
| InChIKey | XWMIKHGSRMDQDQ-SOFGYWHQSA-N |
| XLogP | 2.45 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|