C8H6N4O4 — CID 86023507
5-[2-(5-nitrofuran-2-yl)ethenyl]-1,3,4-oxadiazol-2-amine (PubChem CID 86023507) has the molecular formula C8H6N4O4 and a molecular weight of 222.16 g/mol. Its IUPAC name is 5-[2-(5-nitrofuran-2-yl)ethenyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[2-(5-nitrofuran-2-yl)ethenyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 86023507 |
| Molecular Formula | C8H6N4O4 |
| Molecular Weight | 222.16 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 5-[2-(5-nitrofuran-2-yl)ethenyl]-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(C=Cc2ccc([N+](=O)[O-])o2)o1 |
| InChI | InChI=1S/C8H6N4O4/c9-8-11-10-6(16-8)3-1-5-2-4-7(15-5)12(13)14/h1-4H,(H2,9,11) |
| InChIKey | USXVFHBNHGOSSC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.16 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|