About 2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]phenanthro[9,10-d][1,3]oxazole
2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]phenanthro[9,10-d][1,3]oxazole (PubChem CID 177256679) has the molecular formula C21H12N2O4
and a molecular weight of 356.34 g/mol. Its IUPAC name is 2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]phenanthro[9,10-d][1,3]oxazole.
Molecular Properties
| Compound Name | 2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]phenanthro[9,10-d][1,3]oxazole |
| PubChem CID | 177256679 |
| Molecular Formula | C21H12N2O4 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]phenanthro[9,10-d][1,3]oxazole |
| SMILES | O=[N+]([O-])c1ccc(/C=C/c2nc3c4ccccc4c4ccccc4c3o2)o1 |
| InChI | InChI=1S/C21H12N2O4/c24-23(25)19-12-10-13(26-19)9-11-18-22-20-16-7-3-1-5-14(16)15-6-2-4-8-17(15)21(20)27-18/h1-12H/b11-9+ |
| InChIKey | OESRJTOUCKVVDG-PKNBQFBNSA-N |
| XLogP | 5.81 |
| TPSA | 82.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]phenanthro[9,10-d][1,3]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]phenanthro[9,10-d][1,3]oxazole?
The IUPAC name of 2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]phenanthro[9,10-d][1,3]oxazole (CID 177256679) is 2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]phenanthro[9,10-d][1,3]oxazole.
What is the SMILES notation for 2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]phenanthro[9,10-d][1,3]oxazole?
The canonical SMILES for 2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]phenanthro[9,10-d][1,3]oxazole is O=[N+]([O-])c1ccc(/C=C/c2nc3c4ccccc4c4ccccc4c3o2)o1.
What is the InChIKey of 2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]phenanthro[9,10-d][1,3]oxazole?
The InChIKey is OESRJTOUCKVVDG-PKNBQFBNSA-N. The full InChI is InChI=1S/C21H12N2O4/c24-23(25)19-12-10-13(26-19)9-11-18-22-20-16-7-3-1-5-14(16)15-6-2-4-8-17(15)21(20)27-18/h1-12H/b11-9+.
What are the key properties of 2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]phenanthro[9,10-d][1,3]oxazole?
2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]phenanthro[9,10-d][1,3]oxazole has a molecular weight of 356.34 g/mol, XLogP of 5.81, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]phenanthro[9,10-d][1,3]oxazole is sourced from PubChem (CID 177256679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).