C8H6N4O3S2 — CID 16796370
5-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-1,3,4-thiadiazol-2-amine (PubChem CID 16796370) has the molecular formula C8H6N4O3S2 and a molecular weight of 270.30 g/mol. Its IUPAC name is 5-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 16796370 |
| Molecular Formula | C8H6N4O3S2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 5-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(S/C=C/c2ccc([N+](=O)[O-])o2)s1 |
| InChI | InChI=1S/C8H6N4O3S2/c9-7-10-11-8(17-7)16-4-3-5-1-2-6(15-5)12(13)14/h1-4H,(H2,9,10)/b4-3+ |
| InChIKey | KLCVDCKIXNXSSR-ONEGZZNKSA-N |
| XLogP | 2.38 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|