C15H11N3O3S2 — CID 75362276
12-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene (PubChem CID 75362276) has the molecular formula C15H11N3O3S2 and a molecular weight of 345.41 g/mol. Its IUPAC name is 12-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene.
| Compound Name | 12-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene |
|---|---|
| PubChem CID | 75362276 |
| Molecular Formula | C15H11N3O3S2 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 12-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene |
| SMILES | O=[N+]([O-])c1ccc(/C=C/Sc2ncnc3sc4c(c23)CCC4)o1 |
| InChI | InChI=1S/C15H11N3O3S2/c19-18(20)12-5-4-9(21-12)6-7-22-14-13-10-2-1-3-11(10)23-15(13)17-8-16-14/h4-8H,1-3H2/b7-6+ |
| InChIKey | DNAXKMKIYRYGAD-VOTSOKGWSA-N |
| XLogP | 4.44 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|