C11H10N4O3S2 — CID 16625445
N-cyclopropyl-5-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-1,3,4-thiadiazol-2-amine (PubChem CID 16625445) has the molecular formula C11H10N4O3S2 and a molecular weight of 310.36 g/mol. Its IUPAC name is N-cyclopropyl-5-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-cyclopropyl-5-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 16625445 |
| Molecular Formula | C11H10N4O3S2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | N-cyclopropyl-5-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-1,3,4-thiadiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc(/C=C/Sc2nnc(NC3CC3)s2)o1 |
| InChI | InChI=1S/C11H10N4O3S2/c16-15(17)9-4-3-8(18-9)5-6-19-11-14-13-10(20-11)12-7-1-2-7/h3-7H,1-2H2,(H,12,13)/b6-5+ |
| InChIKey | OXFCQUUBKXIMCK-AATRIKPKSA-N |
| XLogP | 3.38 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|