C16H21F3N6O5 — CID 177448307
1-[(E)-(5-nitrofuran-2-yl)methylideneamino]-3-[4-[3-(2,2,2-trifluoroacetyl)-1,3-diazinan-1-yl]butyl]urea (PubChem CID 177448307) has the molecular formula C16H21F3N6O5 and a molecular weight of 434.38 g/mol. Its IUPAC name is 1-[(E)-(5-nitrofuran-2-yl)methylideneamino]-3-[4-[3-(2,2,2-trifluoroacetyl)-1,3-diazinan-1-yl]butyl]urea.
| Compound Name | 1-[(E)-(5-nitrofuran-2-yl)methylideneamino]-3-[4-[3-(2,2,2-trifluoroacetyl)-1,3-diazinan-1-yl]butyl]urea |
|---|---|
| PubChem CID | 177448307 |
| Molecular Formula | C16H21F3N6O5 |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 1-[(E)-(5-nitrofuran-2-yl)methylideneamino]-3-[4-[3-(2,2,2-trifluoroacetyl)-1,3-diazinan-1-yl]butyl]urea |
| SMILES | O=C(NCCCCN1CCCN(C(=O)C(F)(F)F)C1)N/N=C/c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C16H21F3N6O5/c17-16(18,19)14(26)24-9-3-8-23(11-24)7-2-1-6-20-15(27)22-21-10-12-4-5-13(30-12)25(28)29/h4-5,10H,1-3,6-9,11H2,(H2,20,22,27)/b21-10+ |
| InChIKey | ZBCOPLLOACFSPN-UFFVCSGVSA-N |
| XLogP | 1.66 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|