C21H21ClN4O2 — CID 162656938
N-[6-chloro-2-[(E)-2-(4-nitrophenyl)ethenyl]quinolin-4-yl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 162656938) has the molecular formula C21H21ClN4O2 and a molecular weight of 396.88 g/mol. Its IUPAC name is N-[6-chloro-2-[(E)-2-(4-nitrophenyl)ethenyl]quinolin-4-yl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[6-chloro-2-[(E)-2-(4-nitrophenyl)ethenyl]quinolin-4-yl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 162656938 |
| Molecular Formula | C21H21ClN4O2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N-[6-chloro-2-[(E)-2-(4-nitrophenyl)ethenyl]quinolin-4-yl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNc1cc(/C=C/c2ccc([N+](=O)[O-])cc2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C21H21ClN4O2/c1-25(2)12-11-23-21-14-17(24-20-10-6-16(22)13-19(20)21)7-3-15-4-8-18(9-5-15)26(27)28/h3-10,13-14H,11-12H2,1-2H3,(H,23,24)/b7-3+ |
| InChIKey | MVUFGYFFGGUKOD-XVNBXDOJSA-N |
| XLogP | 4.94 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|